CAS 924861-87-0

5-Methyl-3H-imidazo[4,5-b]pyridin-2-amine

Description:

5-Methyl-3H-imidazo[4,5-b]pyridin-2-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 5-position of the imidazole ring and an amino group at the 2-position of the pyridine ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with various biological targets. Its structure allows for the possibility of forming complexes with metal ions, which can be relevant in coordination chemistry. Additionally, the presence of nitrogen atoms in the rings contributes to its basicity and potential as a ligand in various chemical reactions. Overall, 5-Methyl-3H-imidazo[4,5-b]pyridin-2-amine is a compound with diverse chemical characteristics that warrant further investigation.

Formula: C₇H₈N₄

InChI: InChI=1S/C7H8N4/c1-4-2-3-5-6(9-4)11-7(8)10-5/h2-3H,1H3,(H3,8,9,10,11)

InChI key: InChIKey=FTGPRADQMGQNMC-UHFFFAOYSA-N

SMILES: NC=1NC=2C(N1)=NC(C)=CC2

Synonyms:

• 5-Methyl-3H-imidazo[4,5-b]pyridin-2-amine
• 3H-Imidazo[4,5-b]pyridin-2-amine, 5-methyl-