CymitQuimica logo

CAS 924861-88-1

:

6-Chloro-2,3,4,9-tetrahydro-1-(2H-tetrazol-5-yl)-1H-carbazole

Description:
6-Chloro-2,3,4,9-tetrahydro-1-(2H-tetrazol-5-yl)-1H-carbazole is a chemical compound characterized by its complex structure, which includes a carbazole core fused with a tetrazole ring. The presence of a chlorine atom at the 6-position of the carbazole contributes to its unique reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen atoms in the tetrazole moiety. Its tetrahydro configuration indicates that it contains a saturated ring system, which may influence its solubility and stability. The tetrazole group is known for its ability to form strong hydrogen bonds and can enhance the compound's pharmacological properties. This substance may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Additionally, its specific structural features suggest potential applications in fields such as agrochemicals or materials science. As with many chemical compounds, safety and handling precautions should be observed due to its potential reactivity and biological effects.
Formula:C13H12ClN5
InChI:InChI=1S/C13H12ClN5/c14-7-4-5-11-10(6-7)8-2-1-3-9(12(8)15-11)13-16-18-19-17-13/h4-6,9,15H,1-3H2,(H,16,17,18,19)
InChI key:InChIKey=FQGLDMHSPZPFLL-UHFFFAOYSA-N
SMILES:ClC=1C=C2C3=C(C(CCC3)C=4NN=NN4)NC2=CC1
Synonyms:
  • 6-Chloro-2,3,4,9-tetrahydro-1-(2H-tetrazol-5-yl)-1H-carbazole
  • 1H-Carbazole, 6-chloro-2,3,4,9-tetrahydro-1-(2H-tetrazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.