CAS 924861-91-6

5-(1-Hydroxycyclohexyl)-3-isoxazolecarboxamide

Description:

5-(1-Hydroxycyclohexyl)-3-isoxazolecarboxamide, identified by its CAS number 924861-91-6, is a chemical compound that features a unique structure combining a cyclohexyl group with an isoxazole moiety. This compound is characterized by its amide functional group, which contributes to its potential biological activity. The presence of the hydroxy group on the cyclohexyl ring may enhance its solubility and reactivity, influencing its interactions in biological systems. The isoxazole ring is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, 5-(1-Hydroxycyclohexyl)-3-isoxazolecarboxamide represents a class of compounds that may exhibit significant therapeutic potential, warranting further investigation into its applications in drug development and other chemical research fields.

Formula: C₁₀H₁₄N₂O₃

InChI: InChI=1S/C10H14N2O3/c11-9(13)7-6-8(15-12-7)10(14)4-2-1-3-5-10/h6,14H,1-5H2,(H2,11,13)

InChI key: InChIKey=PEAQWCVJGOGQAV-UHFFFAOYSA-N

SMILES: OC1(CCCCC1)C2=CC(C(N)=O)=NO2

Synonyms:

• 5-(1-Hydroxycyclohexyl)-3-isoxazolecarboxamide
• 3-Isoxazolecarboxamide, 5-(1-hydroxycyclohexyl)-

5-(1-Hydroxy-cyclohexyl)-isoxazole-3-carboxylic acid amide

CAS: 924861-91-6

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 210.23 g/mol

Ref: 3D-ZLB86191