CymitQuimica logo

CAS 924862-05-5

:

5-Benzoyl-3-isoxazolecarboxamide

Description:
5-Benzoyl-3-isoxazolecarboxamide is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a benzoyl group, which contributes to its aromatic properties and may influence its reactivity and interaction with biological systems. The carboxamide functional group enhances its solubility in polar solvents and can participate in hydrogen bonding, making it potentially useful in various chemical and pharmaceutical applications. The presence of the isoxazole moiety suggests that it may exhibit biological activity, possibly as an inhibitor or modulator in biochemical pathways. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, the synthesis and characterization of 5-benzoyl-3-isoxazolecarboxamide would involve techniques such as NMR spectroscopy, mass spectrometry, and crystallography to confirm its structure and purity.
Formula:C11H8N2O3
InChI:InChI=1S/C11H8N2O3/c12-11(15)8-6-9(16-13-8)10(14)7-4-2-1-3-5-7/h1-6H,(H2,12,15)
InChI key:InChIKey=WISKSAOLGDKRKR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C(N)=O)=NO1)C2=CC=CC=C2
Synonyms:
  • 3-Isoxazolecarboxamide, 5-benzoyl-
  • 5-Benzoyl-3-isoxazolecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.