
CAS 924862-07-7
:5-Tricyclo[3.3.1.13,7]dec-1-yl-1,3,4-oxadiazol-2-amine
Description:
5-Tricyclo[3.3.1.13,7]dec-1-yl-1,3,4-oxadiazol-2-amine is a chemical compound characterized by its unique bicyclic structure, which incorporates a tricyclic framework and an oxadiazole moiety. The presence of the oxadiazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. The compound's structure suggests it may exhibit interesting electronic properties due to the conjugation between the aromatic systems and the nitrogen atoms in the oxadiazole ring. Additionally, the tricyclic component may influence its steric and electronic interactions, potentially affecting its solubility and reactivity. The amine functional group can participate in hydrogen bonding, which may enhance its interactions with biological targets. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and materials science, although specific applications and biological activities would require further investigation through experimental studies.
Formula:C12H17N3O
InChI:InChI=1S/C12H17N3O/c13-11-15-14-10(16-11)12-4-7-1-8(5-12)3-9(2-7)6-12/h7-9H,1-6H2,(H2,13,15)
InChI key:InChIKey=AFLVWDDWXHKWJM-UHFFFAOYSA-N
SMILES:NC=1OC(C23CC4CC(C2)CC(C3)C4)=NN1
Synonyms:- 1,3,4-Oxadiazol-2-amine, 5-tricyclo[3.3.1.13,7]dec-1-yl-
- 5-Tricyclo[3.3.1.13,7]dec-1-yl-1,3,4-oxadiazol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.