CAS 924865-07-6

6-(1,2,4-triazol-4-yl)pyridine-3-carboxylic acid

Description:

6-(1,2,4-Triazol-4-yl)pyridine-3-carboxylic acid is a heterocyclic compound characterized by the presence of both a pyridine and a triazole ring in its structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential for forming hydrogen bonds. The triazole moiety is known for its stability and ability to participate in coordination chemistry, making this compound of interest in various fields, including medicinal chemistry and material science. It typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group, while its aromatic rings contribute to its overall stability and potential for π-π stacking interactions. The compound may also exhibit biological activity, as many triazole-containing compounds are known for their pharmacological properties. Its unique structural features allow for potential applications in drug design, particularly in targeting specific biological pathways or as a ligand in coordination complexes.

Formula: C₈H₆N₄O₂

InChI: InChI=1/C8H6N4O2/c13-8(14)6-1-2-7(9-3-6)12-4-10-11-5-12/h1-5H,(H,13,14)

SMILES: c1cc(ncc1C(=O)O)n1cnnc1

Synonyms:

• 281232-20-0
• 3-pyridinecarboxylic acid, 6-(4H-1,2,4-triazol-4-yl)-
• 6-([1,2,4]Triazol-4-yl)-nicotinic acid
• 6-(4H-1,2,4-triazol-4-yl)nicotinic acid