
CAS 924865-94-1
:3-[1-(3-Methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid
Description:
3-[1-(3-Methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid, with the CAS number 924865-94-1, is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a methoxyphenyl group and a propenoic acid moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyrrole ring, which is known for its role in various natural products and pharmaceuticals. The methoxy group may enhance lipophilicity, influencing its solubility and interaction with biological systems. The propenoic acid functional group suggests potential reactivity, allowing for further chemical modifications or polymerization. Overall, this compound may be of interest in medicinal chemistry and materials science, particularly in the development of new therapeutic agents or functional materials. Its specific characteristics, such as melting point, solubility, and reactivity, would require empirical data for precise evaluation.
Formula:C16H17NO3
InChI:InChI=1S/C16H17NO3/c1-11-9-13(7-8-16(18)19)12(2)17(11)14-5-4-6-15(10-14)20-3/h4-10H,1-3H3,(H,18,19)
InChI key:InChIKey=XVFZDOMLIYWDMS-UHFFFAOYSA-N
SMILES:CC=1N(C2=CC(OC)=CC=C2)C(C)=CC1C=CC(O)=O
Synonyms:- 2-Propenoic acid, 3-[1-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-
- 3-[1-(3-Methoxyphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.