CAS 924866-04-6

4-Amino-1-(2-phenylethyl)-2-pyrrolidinone

Description:

4-Amino-1-(2-phenylethyl)-2-pyrrolidinone is a chemical compound characterized by its pyrrolidinone structure, which includes a pyrrolidine ring with an amino group and a phenylethyl substituent. This compound typically exhibits properties associated with both amines and cyclic ketones, such as potential basicity due to the amino group and the ability to participate in hydrogen bonding. The presence of the phenylethyl group may influence its lipophilicity, potentially enhancing its ability to cross biological membranes. As a result, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular structure suggests it could interact with various biological targets, although specific biological activities would depend on further empirical studies. Additionally, its stability, solubility, and reactivity would be influenced by the functional groups present, making it essential to consider these factors in practical applications or synthesis. Overall, 4-Amino-1-(2-phenylethyl)-2-pyrrolidinone represents a versatile scaffold for further chemical exploration and potential therapeutic development.

Formula: C₁₂H₁₆N₂O

InChI: InChI=1S/C12H16N2O/c13-11-8-12(15)14(9-11)7-6-10-4-2-1-3-5-10/h1-5,11H,6-9,13H2

InChI key: InChIKey=ISJDDPOYWZLFNJ-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)N2C(=O)CC(N)C2

Synonyms:

• 2-Pyrrolidinone, 4-amino-1-(2-phenylethyl)-
• 4-Amino-1-(2-phenylethyl)-2-pyrrolidinone