CAS 924866-05-7

4-Amino-1-(2-methoxyphenyl)-2-pyrrolidinone

Description:

4-Amino-1-(2-methoxyphenyl)-2-pyrrolidinone, identified by its CAS number 924866-05-7, is an organic compound characterized by its pyrrolidinone structure, which includes a pyrrolidine ring and an amino group. This compound features a methoxy-substituted phenyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The methoxy group enhances its lipophilicity, potentially influencing its biological activity and pharmacokinetics. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the presence of functional groups that can participate in various chemical reactions. Additionally, its structural features suggest it could interact with biological targets, making it a candidate for further research in therapeutic contexts. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₁H₁₄N₂O₂

InChI: InChI=1S/C11H14N2O2/c1-15-10-5-3-2-4-9(10)13-7-8(12)6-11(13)14/h2-5,8H,6-7,12H2,1H3

InChI key: InChIKey=RBNJPVORBOEYBW-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1)N2CC(N)CC2=O

Synonyms:

• 2-Pyrrolidinone, 4-amino-1-(2-methoxyphenyl)-
• 4-Amino-1-(2-methoxyphenyl)-2-pyrrolidinone