CAS 924868-93-9

4-Bromo-2-chloro-6-[(dimethylamino)methyl]phenol

Description:

4-Bromo-2-chloro-6-[(dimethylamino)methyl]phenol is an organic compound characterized by its complex structure, which includes a phenolic group substituted with bromine and chlorine atoms, as well as a dimethylaminomethyl side chain. This compound typically exhibits properties associated with both halogenated phenols and amines, such as potential biological activity and reactivity due to the presence of the halogen substituents. The bromine and chlorine atoms can influence the compound's polarity, solubility, and reactivity, making it useful in various chemical applications, including as an intermediate in organic synthesis. The dimethylamino group contributes to its basicity and can enhance its interaction with biological systems, potentially leading to pharmacological effects. Additionally, the compound's structure suggests it may participate in hydrogen bonding due to the hydroxyl (-OH) group, affecting its physical properties like melting and boiling points. Overall, 4-Bromo-2-chloro-6-[(dimethylamino)methyl]phenol is a versatile compound with significant implications in chemical research and development.

Formula: C₉H₁₁BrClNO

InChI: InChI=1S/C9H11BrClNO/c1-12(2)5-6-3-7(10)4-8(11)9(6)13/h3-4,13H,5H2,1-2H3

InChI key: InChIKey=HONZMVUOKSZIHR-UHFFFAOYSA-N

SMILES: C(N(C)C)C1=C(O)C(Cl)=CC(Br)=C1

Synonyms:

• 4-Bromo-2-chloro-6-[(dimethylamino)methyl]phenol
• Phenol, 4-bromo-2-chloro-6-[(dimethylamino)methyl]-

4-Bromo-2-chloro-6-[(dimethylamino)methyl]phenol

CAS: 924868-93-9

4-Bromo-2-chloro-6-[(dimethylamino)methyl]phenol

Purity: 95%

Molecular weight: 264.55g/mol

Ref: 54-OR15134