CAS 924869-04-5

4-(2-Benzoxazolyl)-1-piperidinepropanoic acid

Description:

4-(2-Benzoxazolyl)-1-piperidinepropanoic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a benzoxazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of both the piperidine and benzoxazole groups suggests that it may have interesting biological activities, possibly acting as a ligand or inhibitor in various biochemical pathways. The carboxylic acid functional group contributes to its acidity and may influence its interaction with biological targets. Additionally, the compound may exhibit moderate to high lipophilicity due to the aromatic benzoxazole component, which can affect its pharmacokinetics and bioavailability. Overall, 4-(2-Benzoxazolyl)-1-piperidinepropanoic acid is of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. However, specific experimental data regarding its reactivity, stability, and biological effects would be necessary for a comprehensive understanding of its characteristics.

Formula: C₁₅H₁₈N₂O₃

InChI: InChI=1S/C15H18N2O3/c18-14(19)7-10-17-8-5-11(6-9-17)15-16-12-3-1-2-4-13(12)20-15/h1-4,11H,5-10H2,(H,18,19)

InChI key: InChIKey=SRSIEKAIKHYKQS-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1CCC(C2=NC=3C(O2)=CC=CC3)CC1

Synonyms:

• 4-(2-Benzoxazolyl)-1-piperidinepropanoic acid
• 1-Piperidinepropanoic acid, 4-(2-benzoxazolyl)-

3-[4-(1,3-Benzoxazol-2-yl)piperidin-1-yl]propanoic acid

CAS: 924869-04-5

3-[4-(1,3-Benzoxazol-2-yl)piperidin-1-yl]propanoic acid

Purity: ≥95%

Molecular weight: 274.32g/mol

Ref: 54-OR15064