CAS 924869-23-8

Ethyl 4-[2-hydroxy-2-[4-(methylsulfonyl)phenyl]ethyl]-1-piperazinecarboxylate

Description:

Ethyl 4-[2-hydroxy-2-[4-(methylsulfonyl)phenyl]ethyl]-1-piperazinecarboxylate, identified by its CAS number 924869-23-8, is a chemical compound characterized by its complex structure, which includes a piperazine ring, an ethyl ester group, and a hydroxyl group. This compound features a methylsulfonyl group attached to a phenyl ring, contributing to its potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, which is common for compounds with similar functional groups. The presence of the piperazine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its specific interactions and properties can be influenced by the substituents on the aromatic ring and the piperazine nitrogen atoms, making it a subject of interest for further research in drug design and synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₆H₂₄N₂O₅S

InChI: InChI=1S/C16H24N2O5S/c1-3-23-16(20)18-10-8-17(9-11-18)12-15(19)13-4-6-14(7-5-13)24(2,21)22/h4-7,15,19H,3,8-12H2,1-2H3

InChI key: InChIKey=KLGYENIHJOWWRV-UHFFFAOYSA-N

SMILES: C(CN1CCN(C(OCC)=O)CC1)(O)C2=CC=C(S(C)(=O)=O)C=C2

Synonyms:

• Ethyl 4-[2-hydroxy-2-[4-(methylsulfonyl)phenyl]ethyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[2-hydroxy-2-[4-(methylsulfonyl)phenyl]ethyl]-, ethyl ester

Ethyl 4-{2-hydroxy-2-[4-(methylsulphonyl)phenyl]ethyl}piperazine-1-carboxylate

CAS: 924869-23-8

Ethyl 4-{2-hydroxy-2-[4-(methylsulphonyl)phenyl]ethyl}piperazine-1-carboxylate

Purity: 95%

Molecular weight: 356.44g/mol

Ref: 54-OR14122