CAS 924871-09-0

3-[1-(3-Ethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid

Description:

3-[1-(3-Ethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid, with the CAS number 924871-09-0, is an organic compound characterized by its unique structure that includes a pyrrole ring and an acrylic acid moiety. This compound features a 3-ethylphenyl substituent, which contributes to its hydrophobic characteristics, and two methyl groups on the pyrrole ring that can influence its reactivity and steric properties. The presence of the propenoic acid functional group suggests potential for reactivity in polymerization or other chemical transformations. The compound may exhibit biological activity, making it of interest in medicinal chemistry or material science. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound's structural features suggest it could serve as a versatile building block in organic synthesis or as a candidate for further functionalization in various chemical applications.

Formula: C₁₇H₁₉NO₂

InChI: InChI=1S/C17H19NO2/c1-4-14-6-5-7-16(11-14)18-12(2)10-15(13(18)3)8-9-17(19)20/h5-11H,4H2,1-3H3,(H,19,20)

InChI key: InChIKey=NIJPPLZRTIYNSS-UHFFFAOYSA-N

SMILES: CC=1N(C2=CC(CC)=CC=C2)C(C)=CC1C=CC(O)=O

Synonyms:

• 2-Propenoic acid, 3-[1-(3-ethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-
• 3-[1-(3-Ethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid