CAS 924871-18-1

1,2-Dihydro-4-methyl-2-oxo-6-quinolineacetic acid

Description:

1,2-Dihydro-4-methyl-2-oxo-6-quinolineacetic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its saturation. The compound contains a methyl group and a keto group, which are significant for its reactivity and potential biological activity. The acetic acid moiety suggests that it may exhibit acidic properties, influencing its solubility and interaction with other molecules. Typically, compounds like this may be investigated for their pharmacological properties, as quinoline derivatives are known for various biological activities, including antimicrobial and anti-inflammatory effects. The specific arrangement of functional groups in 1,2-Dihydro-4-methyl-2-oxo-6-quinolineacetic acid may also affect its stability, reactivity, and potential applications in medicinal chemistry or as a synthetic intermediate. Overall, this compound represents a unique structure with potential significance in chemical and pharmaceutical research.

Formula: C₁₂H₁₁NO₃

InChI: InChI=1S/C12H11NO3/c1-7-4-11(14)13-10-3-2-8(5-9(7)10)6-12(15)16/h2-5H,6H2,1H3,(H,13,14)(H,15,16)

InChI key: InChIKey=DFXDYPDRZDFRDI-UHFFFAOYSA-N

SMILES: CC=1C=2C(NC(=O)C1)=CC=C(CC(O)=O)C2

Synonyms:

• 6-Quinolineacetic acid, 1,2-dihydro-4-methyl-2-oxo-
• 1,2-Dihydro-4-methyl-2-oxo-6-quinolineacetic acid
• 2-(2-Hydroxy-4-methylquinolin-6-yl)acetic acid
• (4-Methyl-2-oxo-1,2-dihydro-quinolin-6-yl)-acetic acid
• 2-(4-Methyl-2-oxo-1,2-dihydroquinolin-6-yl)acetic acid