CAS 924871-26-1
:3-(4-Methyl-1,2,5-oxadiazol-3-yl)-1,2,4-oxadiazole-5-butanoic acid
Description:
3-(4-Methyl-1,2,5-oxadiazol-3-yl)-1,2,4-oxadiazole-5-butanoic acid is a chemical compound characterized by its unique structure, which includes multiple oxadiazole rings and a butanoic acid moiety. This compound features a 4-methyl substitution on one of the oxadiazole rings, contributing to its chemical properties and potential biological activity. The presence of the oxadiazole functional groups suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Additionally, the butanoic acid portion of the molecule may impart acidic characteristics, influencing its solubility and reactivity in different environments. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or materials science due to their diverse functional groups and structural complexity. Overall, the unique combination of oxadiazole and butanoic acid functionalities makes this compound a subject of interest in various fields of chemical research.
Formula:C9H10N4O4
InChI:InChI=1S/C9H10N4O4/c1-5-8(12-17-11-5)9-10-6(16-13-9)3-2-4-7(14)15/h2-4H2,1H3,(H,14,15)
InChI key:InChIKey=GUDHYEMCRWIIGK-UHFFFAOYSA-N
SMILES:CC=1C(=NON1)C=2N=C(CCCC(O)=O)ON2
Synonyms:- 3-(4-Methyl-1,2,5-oxadiazol-3-yl)-1,2,4-oxadiazole-5-butanoic acid
- 1,2,4-Oxadiazole-5-butanoic acid, 3-(4-methyl-1,2,5-oxadiazol-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.