CAS 924871-50-1

5-(1-Hydroxycyclohexyl)-3-isoxazolecarboxylic acid hydrazide

Description:

5-(1-Hydroxycyclohexyl)-3-isoxazolecarboxylic acid hydrazide, with the CAS number 924871-50-1, is a chemical compound characterized by its unique structural features, including a hydrazide functional group and an isoxazole ring. This compound typically exhibits properties associated with both hydrazides and isoxazoles, such as potential biological activity and the ability to form hydrogen bonds due to the presence of hydroxyl and amine groups. The hydrazide moiety may contribute to its reactivity, particularly in forming derivatives or participating in condensation reactions. Additionally, the cyclohexyl group can influence the compound's lipophilicity and overall solubility in organic solvents. Such characteristics may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific applications and biological activities would require further investigation through empirical studies. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₀H₁₅N₃O₃

InChI: InChI=1S/C10H15N3O3/c11-12-9(14)7-6-8(16-13-7)10(15)4-2-1-3-5-10/h6,15H,1-5,11H2,(H,12,14)

InChI key: InChIKey=JVCGABRGSLTHOF-UHFFFAOYSA-N

SMILES: OC1(CCCCC1)C2=CC(C(NN)=O)=NO2

Synonyms:

• 5-(1-Hydroxycyclohexyl)-3-isoxazolecarboxylic acid hydrazide
• 3-Isoxazolecarboxylic acid, 5-(1-hydroxycyclohexyl)-, hydrazide