
CAS 924871-51-2
:Ethyl 5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-3-isoxazolecarboxylate
Description:
Ethyl 5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-3-isoxazolecarboxylate is a chemical compound characterized by its complex structure, which includes an isoxazole ring and a benzodioxole moiety. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of methoxy groups on the benzodioxole enhances its electron-donating properties, potentially influencing its biological activity. The isoxazole ring is known for its involvement in various pharmacological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or cardiovascular conditions. Additionally, the compound's unique arrangement of functional groups may lead to interesting interactions with biological targets, warranting further investigation into its pharmacokinetics and pharmacodynamics. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of such derivatives in the field of organic and medicinal chemistry.
Formula:C16H19NO7
InChI:InChI=1S/C16H19NO7/c1-4-21-16(18)11-7-10(24-17-11)5-9-6-12(19-2)14-15(13(9)20-3)23-8-22-14/h6,10H,4-5,7-8H2,1-3H3
InChI key:InChIKey=BHBCXOMVVGUZPE-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(OC)C=C1CC3CC(C(OCC)=O)=NO3)OCO2
Synonyms:- Ethyl 5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-3-isoxazolecarboxylate
- 3-Isoxazolecarboxylic acid, 5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.