CAS 924871-53-4

4-Chloro-2-methyl-6-phenoxyquinoline

Description:

4-Chloro-2-methyl-6-phenoxyquinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chloro group at the 4-position and a methyl group at the 2-position contributes to its unique reactivity and potential biological activity. The phenoxy group at the 6-position enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. This compound is typically synthesized through multi-step organic reactions, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, including antimicrobial or anticancer properties, although specific activity would depend on further empirical studies. As with many organic compounds, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, 4-Chloro-2-methyl-6-phenoxyquinoline represents a class of compounds that could be of interest in both research and industrial applications.

Formula: C₁₆H₁₂ClNO

InChI: InChI=1S/C16H12ClNO/c1-11-9-15(17)14-10-13(7-8-16(14)18-11)19-12-5-3-2-4-6-12/h2-10H,1H3

InChI key: InChIKey=VKHHSBAHVMIEFM-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=C(C)C1)C=CC(OC3=CC=CC=C3)=C2

Synonyms:

• 4-Chloro-2-methyl-6-phenoxyquinoline
• Quinoline, 4-chloro-2-methyl-6-phenoxy-