
CAS 924871-66-9
:5-(3,4-Dimethoxyphenyl)-2H-tetrazole-2-ethanol
Description:
5-(3,4-Dimethoxyphenyl)-2H-tetrazole-2-ethanol, identified by its CAS number 924871-66-9, is a chemical compound characterized by its tetrazole ring, which is a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features a 3,4-dimethoxyphenyl group, indicating the presence of two methoxy (-OCH3) substituents on a phenyl ring, which can influence its solubility and reactivity. The presence of the ethanol moiety suggests that it has hydroxyl (-OH) functionality, which can enhance its hydrogen bonding capabilities and may affect its biological activity. The structural features of this compound may contribute to its potential applications in pharmaceuticals or as a chemical intermediate. Additionally, the presence of both aromatic and heterocyclic components may impart unique electronic properties, making it of interest in various chemical and biological studies. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C11H14N4O3
InChI:InChI=1S/C11H14N4O3/c1-17-9-4-3-8(7-10(9)18-2)11-12-14-15(13-11)5-6-16/h3-4,7,16H,5-6H2,1-2H3
InChI key:InChIKey=ZGAQJGBGHZGHLB-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1OC)C2=NN(CCO)N=N2
Synonyms:- 5-(3,4-Dimethoxyphenyl)-2H-tetrazole-2-ethanol
- 2H-Tetrazole-2-ethanol, 5-(3,4-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.