CAS 924873-23-4
:2-[(4-Methyl-1-piperidinyl)sulfonyl]ethanamine
Description:
2-[(4-Methyl-1-piperidinyl)sulfonyl]ethanamine, identified by its CAS number 924873-23-4, is a chemical compound characterized by its sulfonamide functional group, which is linked to an ethanamine moiety. This compound features a piperidine ring substituted with a methyl group, contributing to its structural complexity and potential biological activity. The sulfonyl group enhances the compound's solubility and reactivity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperidine ring suggests potential interactions with biological targets, such as receptors or enzymes, which may lead to therapeutic effects. Additionally, the compound's properties, including its polarity, stability, and potential for hydrogen bonding, can influence its pharmacokinetics and pharmacodynamics. Overall, 2-[(4-Methyl-1-piperidinyl)sulfonyl]ethanamine represents a class of compounds that may exhibit significant biological activity, warranting further investigation in drug discovery and development.
Formula:C8H18N2O2S
InChI:InChI=1S/C8H18N2O2S/c1-8-2-5-10(6-3-8)13(11,12)7-4-9/h8H,2-7,9H2,1H3
InChI key:InChIKey=NKNUNVASIQRYJZ-UHFFFAOYSA-N
SMILES:S(CCN)(=O)(=O)N1CCC(C)CC1
Synonyms:- 2-[(4-Methyl-1-piperidinyl)sulfonyl]ethanamine
- Ethanamine, 2-[(4-methyl-1-piperidinyl)sulfonyl]-
- 2-(4-Methyl-piperidine-1-sulfonyl)-ethylaMine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.