CymitQuimica logo

CAS 924876-61-9

:

3-[3,5-Dimethoxy-4-(4-thiazolylmethoxy)phenyl]-2-propenoic acid

Description:
3-[3,5-Dimethoxy-4-(4-thiazolylmethoxy)phenyl]-2-propenoic acid, with the CAS number 924876-61-9, is an organic compound characterized by its complex structure, which includes a propenoic acid moiety and a phenyl ring substituted with both methoxy and thiazole groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the propenoic acid functional group, which can participate in various chemical reactions, including esterification and polymerization. The thiazole ring may contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Its methoxy groups can influence its electronic properties and steric hindrance, affecting its interactions with biological targets. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C15H15NO5S
InChI:InChI=1S/C15H15NO5S/c1-19-12-5-10(3-4-14(17)18)6-13(20-2)15(12)21-7-11-8-22-9-16-11/h3-6,8-9H,7H2,1-2H3,(H,17,18)
InChI key:InChIKey=OMHSXOBXJPFEOK-UHFFFAOYSA-N
SMILES:O(CC1=CSC=N1)C2=C(OC)C=C(C=CC(O)=O)C=C2OC
Synonyms:
  • 2-Propenoic acid, 3-[3,5-dimethoxy-4-(4-thiazolylmethoxy)phenyl]-
  • 3-[3,5-Dimethoxy-4-(4-thiazolylmethoxy)phenyl]-2-propenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.