CymitQuimica logo

CAS 92491-67-3

:

O-tert-Butyl-N-4-nitrophenylcarbazate

Description:
O-tert-Butyl-N-4-nitrophenylcarbazate is a chemical compound characterized by its structure, which includes a tert-butyl group, a nitrophenyl moiety, and a carbazate functional group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the tert-butyl group enhances the compound's stability and solubility in organic solvents. O-tert-Butyl-N-4-nitrophenylcarbazate may exhibit specific physical properties such as melting point and solubility characteristics, which are important for its handling and application in laboratory settings. Safety data should be consulted to understand its toxicity and environmental impact, as with any chemical substance. Overall, this compound serves as a valuable building block in synthetic organic chemistry.
Formula:C11H15N3O4
InChI:InChI=1/C11H15N3O4/c1-11(2,3)18-10(15)13-12-8-4-6-9(7-5-8)14(16)17/h4-7,12H,1-3H3,(H,13,15)
SMILES:CC(C)(C)OC(=NNc1ccc(cc1)N(=O)=O)O
Synonyms:
  • Tert-Butyl 2-(4-Nitrophenyl)Hydrazinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.