CymitQuimica logo

CAS 924964-17-0

:

1,3,2-Dioxaborolane, 2-[4-bromo-2,5-bis(bromomethyl)phenyl]-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-[4-bromo-2,5-bis(bromomethyl)phenyl]-4,4,5,5-tetramethyl- is a boron-containing heterocyclic compound characterized by its dioxaborolane ring structure, which features a five-membered ring containing two oxygen atoms and a boron atom. This compound is notable for its incorporation of brominated phenyl groups, which can enhance its reactivity and potential applications in organic synthesis, particularly in cross-coupling reactions. The presence of multiple bromomethyl groups suggests that it may serve as a versatile building block in the synthesis of more complex organic molecules. Additionally, the tetramethyl substitution on the dioxaborolane ring can influence its solubility and stability. As with many organoboron compounds, it may exhibit unique properties such as selective reactivity and the ability to form stable complexes with various nucleophiles. Its specific applications would depend on its reactivity profile and the context of its use in synthetic chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C14H18BBr3O2
InChI:InChI=1S/C14H18BBr3O2/c1-13(2)14(3,4)20-15(19-13)11-5-10(8-17)12(18)6-9(11)7-16/h5-6H,7-8H2,1-4H3
InChI key:InChIKey=PVKAZVUJYHNEEI-UHFFFAOYSA-N
SMILES:C(Br)C1=C(C=C(CBr)C(Br)=C1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 2-[4-Bromo-2,5-bis(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 2-[4-bromo-2,5-bis(bromomethyl)phenyl]-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.