CymitQuimica logo

CAS 924964-21-6

:

5-(2H-Tetrazol-5-yl)-2-thiophenesulfonyl chloride

Description:
5-(2H-Tetrazol-5-yl)-2-thiophenesulfonyl chloride is a chemical compound characterized by its unique structural features, which include a thiophene ring and a tetrazole moiety. This compound typically exhibits properties associated with sulfonyl chlorides, such as high reactivity due to the presence of the sulfonyl chloride functional group, making it useful in various synthetic applications, particularly in the formation of sulfonamides and other derivatives. The tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their pharmacological properties. The compound is likely to be a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage conditions. Its reactivity with nucleophiles can facilitate the introduction of various functional groups, making it a valuable intermediate in organic synthesis. Additionally, the presence of both the thiophene and tetrazole structures may impart unique electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological systems.
Formula:CH2N4S
InChI:InChI=1S/C5H3ClN4O2S2/c6-14(11,12)4-2-1-3(13-4)5-7-9-10-8-5/h1-2H,(H,7,8,9,10)
InChI key:InChIKey=CRGNDNVYOIZJQY-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1SC(=CC1)C=2NN=NN2
Synonyms:
  • 5-(2H-Tetrazol-5-yl)-2-thiophenesulfonyl chloride
  • 2-Thiophenesulfonyl chloride, 5-(2H-tetrazol-5-yl)-
  • 5-(1H-tetrazol-5-yl)thiophene-2-sulfonyl chloride
  • 5-(1H-tetrazol-5-yl)thiop...
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.