CAS 924969-61-9
:2-Bromo-N-(2-chlorophenyl)butanamide
Description:
2-Bromo-N-(2-chlorophenyl)butanamide is an organic compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a bromine atom and a chlorophenyl group contributes to its unique chemical properties. This compound features a butanamide backbone, where the butane chain is substituted with a bromine atom at the second carbon position and a 2-chlorophenyl group attached to the nitrogen atom of the amide. The halogen substituents (bromine and chlorine) can influence the compound's reactivity, polarity, and potential biological activity. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of halogens can enhance lipophilicity, affecting the compound's solubility and interaction with biological membranes. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose environmental and health risks.
Formula:C10H11BrClNO
InChI:InChI=1S/C10H11BrClNO/c1-2-7(11)10(14)13-9-6-4-3-5-8(9)12/h3-7H,2H2,1H3,(H,13,14)
InChI key:InChIKey=FFXIBZWKPQIZNC-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=C(Cl)C=CC=C1
Synonyms:- Butanamide, 2-bromo-N-(2-chlorophenyl)-
- 2-Bromo-N-(2-chlorophenyl)butanamide
- STK278614
- 2-bromo-N-(2-chlorophenyl)butyramide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.