CAS 925-54-2
:2-Methylhexanal
Description:
2-Methylhexanal is an organic compound classified as an aldehyde, characterized by its six-carbon chain with a methyl group attached to the second carbon. Its molecular formula is C7H14O, and it features a carbonyl group (C=O) at the terminal position, which is typical of aldehydes. This compound is typically a colorless liquid with a distinctive, pleasant odor, often described as fruity or nutty. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic hydrocarbon chain. 2-Methylhexanal is used in various applications, including as a flavoring agent and in the synthesis of other organic compounds. Its reactivity is influenced by the presence of the aldehyde functional group, making it susceptible to oxidation and reduction reactions. Additionally, it can participate in various chemical reactions, such as nucleophilic addition and condensation. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes.
Formula:C7H14O
InChI:InChI=1/C7H14O/c1-3-4-5-7(2)6-8/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=BHVGMUDWABJNRC-UHFFFAOYSA-N
SMILES:C(CCCC)(C=O)C
Synonyms:- Hexanal, 2-methyl-
- α-Methylcapronaldehyde
- 2-Methyl-1-hexanal
- 2-Methylhexanal
- 2-Methylhexanaldehyde
- Einecs 213-118-4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
