CAS 92500-17-9
:1-(5-acetyl-2-hydroxybenzyl)piperidinium
Description:
1-(5-acetyl-2-hydroxybenzyl)piperidinium, identified by its CAS number 92500-17-9, is a chemical compound that features a piperidine ring substituted with a 5-acetyl-2-hydroxybenzyl group. This structure suggests that it possesses both aromatic and aliphatic characteristics, which can influence its reactivity and solubility. The presence of the hydroxyl group indicates potential for hydrogen bonding, which may enhance its solubility in polar solvents. The acetyl group can also participate in various chemical reactions, such as acylation or condensation, making the compound versatile in synthetic applications. Additionally, the piperidinium moiety may impart basic properties, allowing it to interact with acids and other electrophiles. Overall, this compound may exhibit interesting biological activities, potentially making it relevant in pharmaceutical research or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C14H20NO2
InChI:InChI=1/C14H19NO2/c1-11(16)12-5-6-14(17)13(9-12)10-15-7-3-2-4-8-15/h5-6,9,17H,2-4,7-8,10H2,1H3/p+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.