
CAS 92507-97-6
:1-Ethyl-2,3-dimethylimidazolium chloride
Description:
1-Ethyl-2,3-dimethylimidazolium chloride is an ionic liquid, characterized by its low volatility and high thermal stability. As a member of the imidazolium family, it features a cationic structure that includes an ethyl group and two methyl groups attached to the imidazole ring, contributing to its unique properties. This compound is typically colorless to pale yellow and exhibits a relatively low melting point, making it liquid at room temperature. Its ionic nature imparts excellent solvation capabilities, making it a suitable solvent for various chemical reactions and processes, particularly in organic synthesis and electrochemistry. Additionally, it demonstrates good conductivity and can act as a medium for ionic transport. The chloride anion enhances its stability and solubility in polar solvents. Due to its tunable properties, 1-Ethyl-2,3-dimethylimidazolium chloride is often explored in applications such as catalysis, extraction processes, and as a green solvent alternative in chemical manufacturing. Its environmental impact is generally considered lower than traditional organic solvents, aligning with sustainable chemistry practices.
Formula:C7H13N2
InChI:InChI=1/C7H13N2/c1-4-9-6-5-8(3)7(9)2/h5-6H,4H2,1-3H3/q+1
SMILES:CCN1C=CN(C)C1C
Synonyms:- 1-ethyl-2,3-dimethyl-1H-imidazol-3-ium chloride
- 1-ethyl-2,3-dimethyl-1H-imidazol-3-ium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Ethyl-2,3-dimethylimidazolium chloride, 97%
CAS:It is used reaction media for chemical processes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not chanFormula:C7H13N2Purity:97%Molecular weight:125.191-Ethyl-2,3-dimethyl-1H-imidazol-3-ium chloride
CAS:Formula:C7H13ClN2Purity:%Color and Shape:SolidMolecular weight:160.64451-Ethyl-2,3-Dimethylimidazolium Chloride
CAS:1-Ethyl-2,3-Dimethylimidazolium ChloridePurity:98%Molecular weight:160.64g/mol



