CAS 92513-34-3

2,7,8-Trimethyl-3-quinolinecarboxylic acid

Description:

2,7,8-Trimethyl-3-quinolinecarboxylic acid is an organic compound belonging to the quinoline family, characterized by a quinoline ring structure with three methyl groups at the 2, 7, and 8 positions and a carboxylic acid functional group at the 3 position. This compound is typically a yellow to brown solid and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the quinoline ring. It exhibits properties typical of carboxylic acids, including the ability to form hydrogen bonds and participate in acid-base reactions. The presence of the methyl groups can influence its reactivity and stability, potentially enhancing its lipophilicity. 2,7,8-Trimethyl-3-quinolinecarboxylic acid may have applications in pharmaceuticals, agrochemicals, or as a biochemical probe due to its structural features. Additionally, its derivatives may exhibit biological activity, making it of interest in medicinal chemistry. As with many quinoline derivatives, it may also possess fluorescent properties, which can be useful in various analytical applications.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1S/C13H13NO2/c1-7-4-5-10-6-11(13(15)16)9(3)14-12(10)8(7)2/h4-6H,1-3H3,(H,15,16)

InChI key: InChIKey=KNGACCJHYQQKRJ-UHFFFAOYSA-N

SMILES: CC=1C2=C(C=C(C(O)=O)C(C)=N2)C=CC1C

Synonyms:

• 2,7,8-Trimethyl-3-quinolinecarboxylic acid
• 3-Quinolinecarboxylic Acid, 2,7,8-Trimethyl-

2,7,8-Trimethylquinoline-3-carboxylic acid

CAS: 92513-34-3

2,7,8-Trimethylquinoline-3-carboxylic acid

Formula: C₁₃H₁₃NO₂

Purity: 95%

Color and Shape: light yellow powder

Molecular weight: 215.24782g/mol

Ref: 54-OR307854