CAS 925142-81-0
:1-[1-(3-chlorophenyl)-1H-pyrazol-4-yl]ethanone
Description:
1-[1-(3-chlorophenyl)-1H-pyrazol-4-yl]ethanone, with the CAS number 925142-81-0, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 3-chlorophenyl group, indicating the presence of a chlorine atom on the phenyl ring, which can influence its reactivity and biological activity. The ethanone functional group suggests that it has a ketone structure, contributing to its potential as a reactive electrophile. The presence of both the pyrazole and phenyl moieties may impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Typically, compounds of this nature can exhibit a range of biological activities, including anti-inflammatory or anticancer properties, depending on their specific structure and substituents. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the chlorine atom and the overall molecular structure, which are important considerations for its application in research and development.
Formula:C11H9ClN2O
InChI:InChI=1/C11H9ClN2O/c1-8(15)9-6-13-14(7-9)11-4-2-3-10(12)5-11/h2-7H,1H3
SMILES:CC(=O)c1cnn(c1)c1cccc(c1)Cl
Synonyms:- ethanone, 1-[1-(3-chlorophenyl)-1H-pyrazol-4-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
