CAS 925154-91-2
:7-(Hexahydro-1H-azepin-1-yl)-2,1,3-benzoxadiazol-4-amine
Description:
7-(Hexahydro-1H-azepin-1-yl)-2,1,3-benzoxadiazol-4-amine, identified by its CAS number 925154-91-2, is a chemical compound characterized by its unique structural features, which include a benzoxadiazole moiety and a hexahydroazepine ring. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, potentially influencing its solubility, stability, and reactivity. The presence of the amine functional group suggests it may engage in hydrogen bonding, which can affect its interactions in biological systems or chemical reactions. Such compounds are often investigated for their potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound's unique structure may confer interesting biological activities, making it a subject of interest in medicinal chemistry and related fields.
Formula:C12H16N4O
InChI:InChI=1S/C12H16N4O/c13-9-5-6-10(12-11(9)14-17-15-12)16-7-3-1-2-4-8-16/h5-6H,1-4,7-8,13H2
InChI key:InChIKey=JQSXJDAYPWALCR-UHFFFAOYSA-N
SMILES:NC=1C=2C(C(=CC1)N3CCCCCC3)=NON2
Synonyms:- 2,1,3-Benzoxadiazol-4-amine, 7-(hexahydro-1H-azepin-1-yl)-
- 7-(Hexahydro-1H-azepin-1-yl)-2,1,3-benzoxadiazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.