CAS 925155-57-3

1-[1-(2-chlorophenyl)-1H-pyrazol-4-yl]ethanone

Description:

1-[1-(2-chlorophenyl)-1H-pyrazol-4-yl]ethanone, with the CAS number 925155-57-3, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 2-chlorophenyl group, indicating the presence of a chlorine atom on a phenyl ring that is attached to the pyrazole structure. The ethanone functional group suggests that it contains a carbonyl (C=O) group adjacent to an ethyl group. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and it may be investigated for its pharmacological properties. Additionally, the presence of the chlorine substituent can influence its reactivity and solubility, affecting its behavior in different chemical environments. Overall, this compound represents a class of pyrazole derivatives that can be explored for various applications in drug development and chemical synthesis.

Formula: C₁₁H₉ClN₂O

InChI: InChI=1/C11H9ClN2O/c1-8(15)9-6-13-14(7-9)11-5-3-2-4-10(11)12/h2-7H,1H3

SMILES: CC(=O)c1cnn(c1)c1ccccc1Cl

Synonyms:

• ethanone, 1-[1-(2-chlorophenyl)-1H-pyrazol-4-yl]-

1-[1-(2-Chlorophenyl)-1H-pyrazol-4-yl]ethanone

CAS: 925155-57-3

Formula: C₁₁H₉ClN₂O

Molecular weight: 220.6550

Ref: IN-DA00GTQQ