CAS 92516-60-4
:methyl 2,3,4-tri-O-benzoyl-6-O-[(4-methylphenyl)sulfonyl]hexopyranoside
Description:
Methyl 2,3,4-tri-O-benzoyl-6-O-[(4-methylphenyl)sulfonyl]hexopyranoside is a complex organic compound characterized by its structural features, which include multiple benzoyl groups and a sulfonyl moiety. This compound belongs to the class of glycosides, specifically a methyl glycoside derivative, which indicates the presence of a methoxy group attached to a hexopyranose sugar unit. The benzoyl groups serve as protective groups for hydroxyl functionalities, enhancing the compound's stability and solubility in organic solvents. The sulfonyl group, particularly with a para-methylphenyl substituent, contributes to the compound's reactivity and potential applications in organic synthesis. This compound is typically utilized in carbohydrate chemistry and may serve as an intermediate in the synthesis of more complex molecules. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used. Overall, this compound exemplifies the intricate nature of synthetic organic chemistry, particularly in the modification and protection of functional groups in carbohydrate derivatives.
Formula:C35H32O11S
InChI:InChI=1/C35H32O11S/c1-23-18-20-27(21-19-23)47(39,40)42-22-28-29(44-32(36)24-12-6-3-7-13-24)30(45-33(37)25-14-8-4-9-15-25)31(35(41-2)43-28)46-34(38)26-16-10-5-11-17-26/h3-21,28-31,35H,22H2,1-2H3
SMILES:Cc1ccc(cc1)S(=O)(=O)OCC1C(C(C(C(OC)O1)OC(=O)c1ccccc1)OC(=O)c1ccccc1)OC(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2,3,4-tri-O-benzoyl-6-O-[(4-methylphenyl)sulfonyl]-α-D-mannopyranoside
CAS:Controlled ProductFormula:C35H32O11SColor and Shape:NeatMolecular weight:660.69
