CAS 92517-43-6

3,3-dimethyl-1,2,3,4,5a,6,7,8,9,9a-decahydrodibenzo[b,d]furan-1-one

Description:

3,3-Dimethyl-1,2,3,4,5a,6,7,8,9,9a-decahydrodibenzo[b,d]furan-1-one, with CAS number 92517-43-6, is a bicyclic compound characterized by its complex fused ring structure. This substance features a decahydrodibenzo[b,d]furan core, which is a polycyclic compound that includes multiple saturated carbon rings. The presence of two methyl groups at the 3-position contributes to its unique chemical properties and steric hindrance. As a ketone, it contains a carbonyl group (C=O), which influences its reactivity and potential applications in organic synthesis. The compound is typically colorless to pale yellow and may exhibit a distinct odor. Its solubility can vary depending on the solvent, and it may show moderate stability under standard conditions. Due to its structural characteristics, it may be of interest in fields such as medicinal chemistry, materials science, and fragrance formulation. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₄H₂₀O₂

InChI: InChI=1/C14H20O2/c1-14(2)7-10(15)13-9-5-3-4-6-11(9)16-12(13)8-14/h9,11H,3-8H2,1-2H3

Synonyms:

• 3,3-dimethyl-3,4,5a,6,7,8,9,9a-octahydrodibenzo[b,d]furan-1(2H)-one

3,3-Dimethyl-1,2,3,4,5a,6,7,8,9,9a-decahydrodibenzo[b,d]furan-1-one

CAS: 92517-43-6

3,3-Dimethyl-1,2,3,4,5a,6,7,8,9,9a-decahydrodibenzo[b,d]furan-1-one

Purity: ≥95%

Molecular weight: 220.31g/mol

Ref: 54-OR72412

3,3-dimethyl-1,2,3,4,5a,6,7,8,9,9a-decahydrodibenzo[b,d]furan-1-one

CAS: 92517-43-6

3,3-dimethyl-1,2,3,4,5a,6,7,8,9,9a-decahydrodibenzo[b,d]furan-1-one

Purity: ≥95%

Ref: 54-OR28530