CAS 92520-16-6

N-[1-(4-bromophenyl)ethyl]acetamide

Description:

N-[1-(4-bromophenyl)ethyl]acetamide, with the CAS number 92520-16-6, is an organic compound characterized by its amide functional group. This substance features a brominated phenyl group attached to an ethyl chain, which is further connected to an acetamide moiety. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. Additionally, the presence of the acetamide group may contribute to hydrogen bonding capabilities, affecting its interactions with other molecules. Overall, N-[1-(4-bromophenyl)ethyl]acetamide is a compound of interest for further research in various chemical and biological contexts.

Formula: C₁₀H₁₂BrNO

InChI: InChI=1/C10H12BrNO/c1-7(12-8(2)13)9-3-5-10(11)6-4-9/h3-7H,1-2H3,(H,12,13)

SMILES: CC(c1ccc(cc1)Br)N=C(C)O

N-[1-(4-Bromophenyl)ethyl]acetamide

CAS: 92520-16-6

Formula: C₁₀H₁₂BrNO

Molecular weight: 242.1124

Ref: IN-DA00GTOP