CAS 925200-30-2

1-(3-Methyl-1H-pyrazol-1-yl)-2-propanone

Description:

1-(3-Methyl-1H-pyrazol-1-yl)-2-propanone, identified by its CAS number 925200-30-2, is an organic compound characterized by the presence of a pyrazole ring and a ketone functional group. This compound features a three-carbon propanone backbone, with a methyl-substituted pyrazole moiety attached to one of the carbon atoms. The pyrazole ring contributes to the compound's potential biological activity, as pyrazoles are known for their diverse pharmacological properties. The presence of the ketone group indicates that the compound may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the molecular structure suggests that it may exhibit polar characteristics, influencing its solubility in different solvents. The compound's unique structure may make it of interest in medicinal chemistry and material science, although specific applications would depend on further research into its properties and reactivity. Overall, 1-(3-Methyl-1H-pyrazol-1-yl)-2-propanone represents a versatile chemical entity with potential utility in various fields.

Formula: C₇H₁₀N₂O

InChI: InChI=1S/C7H10N2O/c1-6-3-4-9(8-6)5-7(2)10/h3-4H,5H2,1-2H3

InChI key: InChIKey=XDMSPPHMAZVVAT-UHFFFAOYSA-N

SMILES: C(C(C)=O)N1N=C(C)C=C1

Synonyms:

• 1-(3-Methyl-1H-pyrazol-1-yl)-2-propanone
• 2-Propanone, 1-(3-methyl-1H-pyrazol-1-yl)-