CAS 92525-10-5
:3-iodo-1-methyl-1H-pyrazole
Description:
3-Iodo-1-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of an iodine atom at the 3-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. It is often used in synthetic organic chemistry as an intermediate in the preparation of various pharmaceuticals and agrochemicals. The iodine substituent can enhance the compound's reactivity, making it useful in nucleophilic substitution reactions. Additionally, the pyrazole moiety is known for its biological activity, which can include anti-inflammatory and analgesic properties. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 3-iodo-1-methyl-1H-pyrazole is a versatile compound with significant applications in chemical synthesis and medicinal chemistry.
Formula:C4H5IN2
InChI:InChI=1/C4H5IN2/c1-7-3-2-4(5)6-7/h2-3H,1H3
SMILES:Cn1ccc(I)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Iodo-1-methyl-1H-pyrazole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H5IN2Purity:97%Color and Shape:Pale yellow to pale brown, Liquid.Molecular weight:208.003-Iodo-1-methyl-1H-pyrazole
CAS:Formula:C4H5IN2Purity:97%Color and Shape:LiquidMolecular weight:208.00043-Iodo-1-methyl-1H-pyrazole
CAS:3-Iodo-1-methyl-1H-pyrazoleFormula:C4H5IN2Purity:≥95%Color and Shape: clear. light yellow liquidMolecular weight:208.00g/mol



