CAS 92525-75-2
:2,3-Diethyl 6-fluoro-2,3-quinolinedicarboxylate
Description:
2,3-Diethyl 6-fluoro-2,3-quinolinedicarboxylate is a chemical compound characterized by its quinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity and fluorescence. The presence of ethyl groups at the 2 and 3 positions enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The fluorine atom at the 6 position can impart unique electronic properties, potentially affecting the compound's reactivity and stability. As a dicarboxylate, it contains two carboxyl functional groups, which can participate in various chemical reactions, including esterification and acid-base reactions. This compound may be of interest in medicinal chemistry and materials science due to its structural features and potential applications. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature, as with any chemical substance.
Formula:C15H14FNO4
InChI:InChI=1S/C15H14FNO4/c1-3-20-14(18)11-8-9-7-10(16)5-6-12(9)17-13(11)15(19)21-4-2/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=CAGDPCQGJPGFON-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(OCC)=O)=NC2=C(C1)C=C(F)C=C2
Synonyms:- 2,3-Diethyl 6-fluoro-2,3-quinolinedicarboxylate
- 2,3-Quinolinedicarboxylic Acid, 6-Fluoro-, Diethyl Ester
- 2,3-Quinolinedicarboxylic acid, 6-fluoro-, 2,3-diethyl ester
- Diethyl 6-fluoroquinoline-2,3-dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.