CymitQuimica logo

CAS 92527-67-8

:

2(3H)-Furanone, dihydro-5-methyl-5-[(phenylmethoxy)methyl]-

Description:
2(3H)-Furanone, dihydro-5-methyl-5-[(phenylmethoxy)methyl]- is an organic compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound features a dihydro substitution, indicating the presence of additional hydrogen atoms that contribute to its saturation. The presence of a methyl group enhances its hydrophobic characteristics, while the phenylmethoxy group introduces an aromatic component, which can influence its reactivity and solubility in organic solvents. The molecular structure suggests potential applications in the synthesis of pharmaceuticals or as a flavoring agent due to its pleasant aroma. Additionally, the compound's unique functional groups may allow for various chemical reactions, including substitution and addition reactions, making it a versatile intermediate in organic synthesis. Its CAS number, 92527-67-8, serves as a unique identifier for regulatory and safety information. Overall, this compound exemplifies the complexity and diversity of organic molecules, with implications in both industrial and research settings.
Formula:C13H16O3
InChI:InChI=1S/C13H16O3/c1-13(8-7-12(14)16-13)10-15-9-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3
InChI key:GTAMIGBAPNHMHJ-UHFFFAOYSA-N
SMILES:CC1(CCC(=O)O1)COCC2=CC=CC=C2
Found 0 products.