CAS 92536-09-9

α-(Aminomethyl)-3-ethoxybenzenemethanol

Description:

α-(Aminomethyl)-3-ethoxybenzenemethanol, with the CAS number 92536-09-9, is an organic compound characterized by its structure, which includes an aminomethyl group, an ethoxy group, and a benzyl alcohol moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The ethoxy group contributes to its hydrophobic characteristics, while the aminomethyl group may impart basicity and reactivity in various chemical reactions. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in hydrogen bonding, influencing its physical properties like boiling and melting points. Additionally, the presence of the aromatic ring may provide stability and influence its reactivity in electrophilic substitution reactions. Overall, α-(Aminomethyl)-3-ethoxybenzenemethanol is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₀H₁₅NO₂

InChI: InChI=1S/C10H15NO2/c1-2-13-9-5-3-4-8(6-9)10(12)7-11/h3-6,10,12H,2,7,11H2,1H3

InChI key: InChIKey=GVEXGRHKOGPJDV-UHFFFAOYSA-N

SMILES: C(CN)(O)C1=CC(OCC)=CC=C1

Synonyms:

• Benzenemethanol, α-(aminomethyl)-3-ethoxy-, (±)-
• 2-Amino-1-(3-ethoxyphenyl)ethan-1-ol
• Benzenemethanol, α-(aminomethyl)-3-ethoxy-
• α-(Aminomethyl)-3-ethoxybenzenemethanol