CymitQuimica logo

CAS 92539-15-6

:

1-[(2-Chlorophenyl)methyl]-4-piperidinamine

Description:
1-[(2-Chlorophenyl)methyl]-4-piperidinamine, also known by its CAS number 92539-15-6, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a 2-chlorobenzyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the chlorophenyl group may impart specific biological activities, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with various biological targets, which could lead to applications in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, particularly the amine and aromatic components. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, 1-[(2-Chlorophenyl)methyl]-4-piperidinamine is a compound of interest for further research, particularly in the context of its pharmacological properties and applications.
Formula:C12H17ClN2
InChI:InChI=1S/C12H17ClN2/c13-12-4-2-1-3-10(12)9-15-7-5-11(14)6-8-15/h1-4,11H,5-9,14H2
InChI key:InChIKey=DAGOWXSFYONSNE-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=CC=C1)N2CCC(N)CC2
Synonyms:
  • 1-(2-Chlorobenzyl)-4-piperidinamine
  • 4-Piperidinamine, 1-[(2-chlorophenyl)methyl]-
  • 1-[(2-Chlorophenyl)methyl]-4-piperidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.