CAS 92545-30-7
:methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-9-hydroxy-6a,10b-dimethyl-4,10-dioxododecahydro-2H-benzo[f]isochromene-7-carboxylate
Description:
The chemical substance with the name "methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-9-hydroxy-6a,10b-dimethyl-4,10-dioxododecahydro-2H-benzo[f]isochromene-7-carboxylate" and CAS number 92545-30-7 is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a furan ring, which contributes to its aromatic properties, and a benzoisochromene structure that enhances its potential biological activity. The presence of hydroxyl and carboxylate groups suggests that it may exhibit polar characteristics, influencing its solubility and reactivity. The compound's stereocenters indicate that it may exist in multiple stereoisomeric forms, which can significantly affect its pharmacological properties. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, including anti-inflammatory or anticancer activities. The specific arrangement of its substituents and the overall three-dimensional conformation play crucial roles in determining its interactions with biological targets. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C21H26O7
InChI:InChI=1/C21H26O7/c1-20-6-4-12-19(25)28-15(11-5-7-27-10-11)9-21(12,2)17(20)16(23)14(22)8-13(20)18(24)26-3/h5,7,10,12-15,17,22H,4,6,8-9H2,1-3H3/t12-,13-,14-,15-,17-,20-,21-/m0/s1
SMILES:C[C@]12CC[C@H]3C(=O)O[C@@H](C[C@]3(C)[C@H]2C(=O)[C@H](C[C@H]1C(=O)OC)O)c1ccoc1
Synonyms:- Divinorin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Salvinorin B 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C21H26O7Color and Shape:Single SolutionMolecular weight:390.43Salvinorin B
CAS:Controlled ProductSalvinorin B is a sesquiterpene lactone that binds to the kappa-opioid receptor and κ-opioid receptor, which are opioid receptors in the central nervous system. Salvinorin B has been found to have analgesic properties and may be used for the treatment of chronic cough. Salvinorin B has also been shown to inhibit locomotor activity and induce symptoms such as hallucinations, delusions, and depersonalization. It is currently being researched for its potential use as an analgesic in cases of autoimmune diseases. Salvinorin B binds to the mu-opioid receptor and inhibits dopamine release in the brain.Formula:C21H26O7Purity:Min. 95%Molecular weight:390.43 g/mol

