CAS 925456-54-8

{4-[(1R)-1-aminoethyl]phenyl}methanol

Description:

{4-[(1R)-1-aminoethyl]phenyl}methanol, with the CAS number 925456-54-8, is an organic compound characterized by its phenolic structure, which includes a hydroxymethyl group attached to a phenyl ring. The presence of the aminoethyl substituent introduces basic properties, allowing for potential interactions with biological systems. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The chiral center at the aminoethyl group indicates that it may exist in enantiomeric forms, which can have different biological activities. Additionally, the compound may participate in various chemical reactions typical of alcohols and amines, such as oxidation or acylation. Its structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of compounds with biological relevance. Overall, the unique combination of functional groups in {4-[(1R)-1-aminoethyl]phenyl}methanol contributes to its chemical reactivity and potential utility in various fields.

Formula: C₉H₁₃NO

InChI: InChI=1/C9H13NO/c1-7(10)9-4-2-8(6-11)3-5-9/h2-5,7,11H,6,10H2,1H3/t7-/m1/s1

SMILES: C[C@H](c1ccc(cc1)CO)N

4-[(1R)-1-Aminoethyl]phenylmethanol

CAS: 925456-54-8

Formula: C₉H₁₃NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.2056

Ref: IN-DA0064FQ

(R)-(4-(1-Aminoethyl)phenyl)methanol

CAS: 925456-54-8

(R)-(4-(1-Aminoethyl)phenyl)methanol

Purity: 95%

Molecular weight: 151.21g/mol

Ref: 54-OR85931

(R)-(4-(1-AMINOETHYL)PHENYL)METHANOL

CAS: 925456-54-8

Formula: C₉H₁₃NO

Purity: 95%

Molecular weight: 151.209

Ref: 10-F467034