
CAS 92552-99-3
:2-(3,4-Dimethoxyphenyl)benzoxazole
Description:
2-(3,4-Dimethoxyphenyl)benzoxazole, with the CAS number 92552-99-3, is an organic compound characterized by its unique structure, which consists of a benzoxazole ring fused with a substituted phenyl group. The presence of two methoxy groups at the 3 and 4 positions of the phenyl ring enhances its electron-donating properties, potentially influencing its reactivity and solubility in various solvents. This compound may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics, such as light-emitting diodes or fluorescent materials. Additionally, the benzoxazole moiety is known for its biological activity, which could suggest potential pharmaceutical applications. The compound's stability, melting point, and solubility characteristics would depend on the specific conditions and solvents used. Overall, 2-(3,4-Dimethoxyphenyl)benzoxazole represents a versatile structure in organic chemistry with potential applications in materials science and medicinal chemistry.
Formula:C15H13NO3
InChI:InChI=1S/C15H13NO3/c1-17-13-8-7-10(9-14(13)18-2)15-16-11-5-3-4-6-12(11)19-15/h3-9H,1-2H3
InChI key:InChIKey=WMXBQSRSJSTSOW-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C2=NC=3C(O2)=CC=CC3)C=CC1OC
Synonyms:- 2-(3,4-Dimethoxyphenyl)-1,3-benzoxazole
- 2-(3,4-Dimethoxy-phenyl)-benzooxazole
- Benzoxazole, 2-(3,4-dimethoxyphenyl)-
- 2-(3,4-Dimethoxyphenyl)benzoxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.