
CAS 92555-69-6
:N-(4-Phenoxyphenyl)-1,3,5-triazine-2,4-diamine
Description:
N-(4-Phenoxyphenyl)-1,3,5-triazine-2,4-diamine, with the CAS number 92555-69-6, is an organic compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features two amino groups and a phenoxyphenyl substituent, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the phenoxy group enhances its solubility and may influence its electronic properties, making it suitable for use in organic electronics or as a dye. The triazine structure is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting photophysical properties, which could be leveraged in optoelectronic applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, N-(4-Phenoxyphenyl)-1,3,5-triazine-2,4-diamine represents a versatile compound with promising characteristics for research and industrial applications.
Formula:C15H13N5O
InChI:InChI=1S/C15H13N5O/c16-14-17-10-18-15(20-14)19-11-6-8-13(9-7-11)21-12-4-2-1-3-5-12/h1-10H,(H3,16,17,18,19,20)
InChI key:KHVFYTGMCVAGIT-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OC2=CC=C(C=C2)NC3=NC=NC(=N3)N
Synonyms:- N2-(4-Phenoxyphenyl)-1,3,5-triazine-2,4-diamine
- STK262958
- N-(4-Phenoxyphenyl)-1,3,5-triazine-2,4-diamine
- (4-amino-s-triazin-2-yl)-[4-(phenoxy)phenyl]amine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery