
CAS 925567-84-6
:2-{[3-(2-METHOXYETHOXY)ANILINO]-CARBONYL}BENZOICACID
Description:
2-{[3-(2-Methoxyethoxy)anilino]-carbonyl}benzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and an aniline derivative. The presence of the methoxyethoxy group suggests that it has ether characteristics, which can influence its solubility and reactivity. This compound likely exhibits both acidic and basic properties due to the carboxylic acid and amine functionalities, respectively. It may participate in hydrogen bonding, enhancing its solubility in polar solvents. The aniline component can contribute to its potential as a dye or pharmaceutical intermediate, while the carbonyl group may play a role in various chemical reactions, such as acylation or condensation. The specific arrangement of functional groups can also affect its biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique structure and functional groups suggest potential applications in drug development and materials science, although further studies would be necessary to fully elucidate its properties and uses.
Formula:C17H17NO5
InChI:InChI=1S/C17H17NO5/c1-22-9-10-23-13-6-4-5-12(11-13)18-16(19)14-7-2-3-8-15(14)17(20)21/h2-8,11H,9-10H2,1H3,(H,18,19)(H,20,21)
InChI key:PVHBIRPQLGHSRF-UHFFFAOYSA-N
SMILES:COCCOC1=CC=CC(=C1)NC(=O)C2=CC=CC=C2C(=O)O
Synonyms:- Benzoic acid, 2-[[[3-(2-methoxyethoxy)phenyl]amino]carbonyl]-
- 2-{[3-(2-METHOXYETHOXY)ANILINO]-CARBONYL}BENZOICACID
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery