CAS 92558-19-5

(14S)-13-oxo-14-[(5-oxo-L-prolyl)amino]-15-[(4S)-2-(trifluoromethyl)-4H-imidazol-4-yl]pentadecanoic acid

Description:

The chemical substance known as (14S)-13-oxo-14-[(5-oxo-L-prolyl)amino]-15-[(4S)-2-(trifluoromethyl)-4H-imidazol-4-yl]pentadecanoic acid, with the CAS number 92558-19-5, is a complex organic compound characterized by its unique structural features. It contains a long-chain fatty acid backbone, which is typical for compounds in the class of fatty acids and their derivatives. The presence of a ketone group (13-oxo) and an amide linkage (5-oxo-L-prolyl) indicates potential biological activity, possibly related to peptide or protein interactions. Additionally, the trifluoromethyl-substituted imidazole moiety suggests that this compound may exhibit interesting pharmacological properties, as trifluoromethyl groups can enhance lipophilicity and metabolic stability. The stereochemistry, indicated by the (14S) and (4S) designations, implies specific spatial arrangements that could influence the compound's reactivity and interactions with biological targets. Overall, this compound may have applications in medicinal chemistry or biochemistry, particularly in the development of therapeutic agents.

Formula: C₂₄H₃₅F₃N₄O₅

InChI: InChI=1/C24H35F3N4O5/c25-24(26,27)23-28-15-16(29-23)14-18(31-22(36)17-12-13-20(33)30-17)19(32)10-8-6-4-2-1-3-5-7-9-11-21(34)35/h15-18H,1-14H2,(H,30,33)(H,31,36)(H,34,35)/t16-,17-,18-/m0/s1

SMILES: C(CCCCCC(=O)[C@H](C[C@H]1C=NC(=N1)C(F)(F)F)N=C([C@@H]1CCC(=N1)O)O)CCCCCC(=O)O