CAS 925701-49-1
:KU-60019
Description:
KU-60019, with the CAS number 925701-49-1, is a chemical compound that functions primarily as a selective inhibitor of the protein kinase ATM (Ataxia Telangiectasia Mutated). This compound is notable for its role in research related to cancer therapy, particularly in enhancing the efficacy of certain chemotherapeutic agents by targeting DNA damage response pathways. KU-60019 exhibits a high degree of specificity for ATM, which is crucial for maintaining genomic stability and responding to DNA double-strand breaks. The compound has been studied for its potential to sensitize cancer cells to radiation and other DNA-damaging agents, making it a valuable tool in the field of oncology. In terms of its physical and chemical properties, KU-60019 is typically characterized by its molecular structure, solubility, and stability under various conditions, although specific values may vary based on experimental conditions. Overall, KU-60019 represents a significant advancement in the development of targeted cancer therapies.
Formula:C30H33N3O5S
InChI:InChI=1S/C30H33N3O5S/c1-19-16-32(17-20(2)37-19)18-28(35)31-23-6-7-27-22(13-23)12-21-4-3-5-25(30(21)39-27)26-14-24(34)15-29(38-26)33-8-10-36-11-9-33/h3-7,13-15,19-20H,8-12,16-18H2,1-2H3,(H,31,35)/t19-,20+
Synonyms:- (2R,6S)-2,6-Dimethyl-N-[5-[6-(4-morpholinyl)-4-oxo-4H-pyran-2-yl]-9H-thioxanthen-2-yl]-4-morpholineacetamide
- 2-[(2R,6S)-2,6-Dimethyl-4-morpholinyl]-N-{5-[6-(4-morpholinyl)-4-oxo-4H-pyran-2-yl]-9H-thioxanthen-2-yl}acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R,6S)-Rel-2,6-Dimethyl-N-[5-[6-(4-Morpholinyl)-4-Oxo-4H-Pyran-2-Yl]-9H-Thioxanthen-2-Yl]-4-Morpholineacetamide
CAS:(2R,6S)-Rel-2,6-Dimethyl-N-[5-[6-(4-Morpholinyl)-4-Oxo-4H-Pyran-2-Yl]-9H-Thioxanthen-2-Yl]-4-MorpholineacetamidePurity:98%Molecular weight:547.68g/molKU60019
CAS:Ku-60019 is a potent, reversible inhibitor of ATM kinase (IC50: 6.3 nM). It is much less effective or without effect against a panel of 229 other kinases.Formula:C30H33N3O5SPurity:95.9% - 99.7%Color and Shape:SolidMolecular weight:547.67KU-60019
CAS:<p>KU-60019 is a potent and selective inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase. KU-60019 blocks the activation of EGFR and other signaling pathways, which may be involved in the pathogenesis of autoimmune diseases, cancer and metabolic disorders. KU-60019 inhibits cellular proliferation by inhibiting tyrosine phosphorylation in the EGFR pathway. In addition, KU-60019 also inhibits DNA synthesis and cell cycle progression by targeting other intracellular targets such as cyclin D1, CDK4, CDK6 and p27. The chemical structure of KU-60019 is similar to that of imatinib mesylate, an inhibitor for chronic myeloid leukemia that has been approved by the FDA for treatment. However, unlike imatinib mesylate, KU-60019 does not inhibit protein kinase C or Raf kinases. Further investigations are needed to determine the mechanism</p>Formula:C30H33N3O5SPurity:Min. 95%Molecular weight:547.67 g/mol



