CymitQuimica logo

CAS 925704-45-6

:

Propanoic acid, 3-amino-2-methyl-, hydrochloride (1:1), (2S)-

Description:
Propanoic acid, 3-amino-2-methyl-, hydrochloride (1:1), (2S)- is an organic compound characterized by its amino acid structure, specifically a derivative of propanoic acid with an amino group and a methyl substituent. This compound features a chiral center, which contributes to its stereochemistry, denoted as (2S)-, indicating the specific spatial arrangement of its atoms. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of both the carboxylic acid and amino functional groups allows it to participate in a range of chemical reactions, including peptide bond formation. Its properties may include moderate melting and boiling points, and it is likely to exhibit typical behavior of amino acids, such as zwitterionic characteristics in solution. This compound may be used in research and development, particularly in the synthesis of biologically active molecules or as a building block in medicinal chemistry.
Formula:C4H9NO2·ClH
InChI:InChI=1S/C4H9NO2.ClH/c1-3(2-5)4(6)7;/h3H,2,5H2,1H3,(H,6,7);1H/t3-;/m0./s1
InChI key:InChIKey=CGGBOMJVYQTWRN-DFWYDOINSA-N
SMILES:[C@@H](C(O)=O)(CN)C.Cl
Synonyms:
  • Propanoic acid, 3-amino-2-methyl-, hydrochloride (1:1), (2S)-
  • (S)-3-Amino-2-methylpropanoic acid hydrochloride
Found 8 products.