CymitQuimica logo

CAS 92574-75-9

:

3(2H)-Pyridazinone, 4,5-dichloro-2-[(phenylmethoxy)methyl]-

Description:
3(2H)-Pyridazinone, 4,5-dichloro-2-[(phenylmethoxy)methyl]- (CAS 92574-75-9) is a chemical compound characterized by its pyridazinone core structure, which features a pyridazine ring with a ketone functional group. The presence of dichloro substituents at the 4 and 5 positions enhances its reactivity and potential biological activity. The phenylmethoxy group attached to the 2-position contributes to its lipophilicity, which may influence its solubility and permeability in biological systems. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial or anti-inflammatory activities. Its molecular structure suggests that it may interact with various biological targets, making it a candidate for further research in drug development. Additionally, the presence of halogen atoms often affects the compound's stability and reactivity, which can be crucial in synthetic applications. Overall, 3(2H)-Pyridazinone, 4,5-dichloro-2-[(phenylmethoxy)methyl]- represents a unique scaffold for exploring new therapeutic agents.
Formula:C12H10Cl2N2O2
InChI:InChI=1S/C12H10Cl2N2O2/c13-10-6-15-16(12(17)11(10)14)8-18-7-9-4-2-1-3-5-9/h1-6H,7-8H2
InChI key:HMPOUYCZGZBFOK-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COCN2C(=O)C(=C(C=N2)Cl)Cl
Found 0 products.